Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Lead(II) acetate trihydrate, 99+%, ACS reagent
CAS: 6080-56-4 Molecular Formula: C4H12O7Pb Molecular Weight (g/mol): 379.30 MDL Number: MFCD00150023 InChI Key: MCEUZMYFCCOOQO-UHFFFAOYSA-L Synonym: lead acetate trihydrate,lead diacetate trihydrate,bleiazetat german,bis acetato trihydroxytrilead,unii-rx077p88ry,ccris 9031,lead acetate ii , trihydrate,lead acetate jan,acetic acid, lead +2 salt trihydrate,acetic acid, lead 2+ salt, trihydrate PubChem CID: 22456 ChEBI: CHEBI:33112 SMILES: O.O.O.[Pb++].CC([O-])=O.CC([O-])=O
| PubChem CID | 22456 |
|---|---|
| CAS | 6080-56-4 |
| Molecular Weight (g/mol) | 379.30 |
| ChEBI | CHEBI:33112 |
| MDL Number | MFCD00150023 |
| SMILES | O.O.O.[Pb++].CC([O-])=O.CC([O-])=O |
| Synonym | lead acetate trihydrate,lead diacetate trihydrate,bleiazetat german,bis acetato trihydroxytrilead,unii-rx077p88ry,ccris 9031,lead acetate ii , trihydrate,lead acetate jan,acetic acid, lead +2 salt trihydrate,acetic acid, lead 2+ salt, trihydrate |
| InChI Key | MCEUZMYFCCOOQO-UHFFFAOYSA-L |
| Molecular Formula | C4H12O7Pb |
Cobalt Chloride Hexahydrate MP Biomedicals
CAS: 7791-13-1 Molecular Formula: Cl2CoH12O6 Molecular Weight (g/mol): 237.92 MDL Number: MFCD00149652 InChI Key: GFHNAMRJFCEERV-UHFFFAOYSA-L Synonym: Cobalt Dichloride Hexahydrate,Cobaltous Chloride, Hexahydrate IUPAC Name: λ²-cobalt(2+) hexahydrate dichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Co++]
| CAS | 7791-13-1 |
|---|---|
| Molecular Weight (g/mol) | 237.92 |
| MDL Number | MFCD00149652 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Co++] |
| Synonym | Cobalt Dichloride Hexahydrate,Cobaltous Chloride, Hexahydrate |
| IUPAC Name | λ²-cobalt(2+) hexahydrate dichloride |
| InChI Key | GFHNAMRJFCEERV-UHFFFAOYSA-L |
| Molecular Formula | Cl2CoH12O6 |
Potassium fluoride, anhydrous, 99%, Thermo Scientific Chemicals
CAS: 7789-23-3 Molecular Formula: FK Molecular Weight (g/mol): 58.10 MDL Number: MFCD00011398 InChI Key: NROKBHXJSPEDAR-UHFFFAOYSA-M Synonym: potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 PubChem CID: 522689 ChEBI: CHEBI:66872 SMILES: [F-].[K+]
| PubChem CID | 522689 |
|---|---|
| CAS | 7789-23-3 |
| Molecular Weight (g/mol) | 58.10 |
| ChEBI | CHEBI:66872 |
| MDL Number | MFCD00011398 |
| SMILES | [F-].[K+] |
| Synonym | potassium fluoride,potassiumfluoride,potassium fluoride kf,potassium fluorure,fluorure de potassium,potassium fluorure french,potassium fluoride on calcium fluoride,potassium fluoride, anhydrous,unii-9082wg1g3f,ccris 1568 |
| InChI Key | NROKBHXJSPEDAR-UHFFFAOYSA-M |
| Molecular Formula | FK |
Manganese(IV) oxide, 99.9% (metals basis)
CAS: 1313-13-9 Molecular Formula: MnO2 Molecular Weight (g/mol): 86.94 MDL Number: MFCD00003463 InChI Key: NUJOXMJBOLGQSY-UHFFFAOYSA-N Synonym: manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein PubChem CID: 14801 IUPAC Name: dioxomanganese SMILES: O=[Mn]=O
| PubChem CID | 14801 |
|---|---|
| CAS | 1313-13-9 |
| Molecular Weight (g/mol) | 86.94 |
| MDL Number | MFCD00003463 |
| SMILES | O=[Mn]=O |
| Synonym | manganese dioxide,manganese iv oxide,manganese peroxide,manganese superoxide,manganese black,manganese binoxide,manganese oxide,mangandioxid,black manganese oxide,braunstein |
| IUPAC Name | dioxomanganese |
| InChI Key | NUJOXMJBOLGQSY-UHFFFAOYSA-N |
| Molecular Formula | MnO2 |
Tetrabutylammonium hydroxide, 1M solution in methanol, AcroSeal™
CAS: 2052-49-5 | C16H37NO | 259.48 g/mol
| Linear Formula | [CH3(CH2)3]4NOH |
|---|---|
| Molecular Weight (g/mol) | 259.48 |
| InChI Key | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| Density | 0.9100g/mL |
| PubChem CID | 2723671 |
| Formula Weight | 259.46 |
| Melting Point | -98.0°C |
| Boiling Point | 65.0°C |
| Color | Colorless to Yellow |
| Physical Form | Solution |
| SMILES | [OH-].CCCC[N+](CCCC)(CCCC)CCCC |
| Concentration or Composition (by Analyte or Components) | 0.95 to 1.1M |
| CAS | 67-56-1 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: Rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if pre |
| MDL Number | MFCD00009425 |
| Health Hazard 2 | GHS H Statement Toxic if swallowed. Toxic in contact with skin. Toxic if inhaled. Causes severe skin burns and eye damage. Causes damage to organs. Highly flammable liquid and vapor. |
| Packaging | AcroSeal™ Glass Bottle |
| Solubility Information | Solubility in water: soluble |
| Flash Point | 12°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Refractive Index | 1.3775 |
| Synonym | tetrabutylammonium hydroxide,tetra-n-butylammonium hydroxide,tetrabutylazanium hydroxide,tetrabutylammoniumhydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide,ammonium, tetrabutyl-, hydroxide,n,n,n-tributyl-1-butanaminium hydroxide,tetra n-butyl ammonium hydroxide,tetra-n-butyl ammonium hydroxide,1-butanaminium, n,n,n-tributyl-, hydroxide 1:1 |
| IUPAC Name | tetrabutylazanium hydroxide |
| Molecular Formula | C16H37NO |
| EINECS Number | 218-147-6 |
| Specific Gravity | 0.91 |
Sodium tetraborate decahydrate, ACS, 99.5-105.0%
CAS: 1303-96-4 Molecular Formula: B4Na2O7·10H2O MDL Number: MFCD00149193 Synonym: Borax,Sodium borate (tetra) decahydrate
| CAS | 1303-96-4 |
|---|---|
| MDL Number | MFCD00149193 |
| Synonym | Borax,Sodium borate (tetra) decahydrate |
| Molecular Formula | B4Na2O7·10H2O |
Copper(II) acetate, anhydrous
CAS: 142-71-2 Molecular Formula: C4H6CuO4 Molecular Weight (g/mol): 181.634 MDL Number: MFCD00008690 InChI Key: OPQARKPSCNTWTJ-UHFFFAOYSA-L Synonym: copper ii acetate,cupric acetate,copper diacetate,copper acetate,venus copper,copper 2+ diacetate,cupric diacetate,neutral verdigris,crystals of venus PubChem CID: 8895 IUPAC Name: copper;diacetate SMILES: CC(=O)[O-].CC(=O)[O-].[Cu+2]
| PubChem CID | 8895 |
|---|---|
| CAS | 142-71-2 |
| Molecular Weight (g/mol) | 181.634 |
| MDL Number | MFCD00008690 |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Cu+2] |
| Synonym | copper ii acetate,cupric acetate,copper diacetate,copper acetate,venus copper,copper 2+ diacetate,cupric diacetate,neutral verdigris,crystals of venus |
| IUPAC Name | copper;diacetate |
| InChI Key | OPQARKPSCNTWTJ-UHFFFAOYSA-L |
| Molecular Formula | C4H6CuO4 |
Copper powder, -100 mesh, 99.999% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Antimony(III) chloride, 99+%
CAS: 10025-91-9 Molecular Formula: Cl3Sb Molecular Weight (g/mol): 228.11 MDL Number: MFCD00011212 InChI Key: FAPDDOBMIUGHIN-UHFFFAOYSA-K Synonym: antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony PubChem CID: 24814 ChEBI: CHEBI:74856 SMILES: [Cl-].[Cl-].[Cl-].[Sb+3]
| PubChem CID | 24814 |
|---|---|
| CAS | 10025-91-9 |
| Molecular Weight (g/mol) | 228.11 |
| ChEBI | CHEBI:74856 |
| MDL Number | MFCD00011212 |
| SMILES | [Cl-].[Cl-].[Cl-].[Sb+3] |
| Synonym | antimony trichloride,trichlorostibine,antimony chloride,antimony iii chloride,stibine, trichloro,antimontrichlorid,antimonous chloride,butter of antimony,antimony butter,caustic antimony |
| InChI Key | FAPDDOBMIUGHIN-UHFFFAOYSA-K |
| Molecular Formula | Cl3Sb |
Zeolite mordenite, sodium
CAS: 1318-02-1 Molecular Formula: Al2O5Si Molecular Weight (g/mol): 162.043 MDL Number: MFCD00132601 InChI Key: HNPSIPDUKPIQMN-UHFFFAOYSA-N Synonym: kaolinite,montmorillonite aluminum pillared clay,silica-alumina catalyst support, grade 135,aidplusocma,bactekillermb,fiberfrax™,bactekillerbm101a,bactekillerbm102a,bactekillerbm501a,kaolinite, natural PubChem CID: 9942228 IUPAC Name: dioxosilane;oxo(oxoalumanyloxy)alumane SMILES: O=[Al]O[Al]=O.O=[Si]=O
| PubChem CID | 9942228 |
|---|---|
| CAS | 1318-02-1 |
| Molecular Weight (g/mol) | 162.043 |
| MDL Number | MFCD00132601 |
| SMILES | O=[Al]O[Al]=O.O=[Si]=O |
| Synonym | kaolinite,montmorillonite aluminum pillared clay,silica-alumina catalyst support, grade 135,aidplusocma,bactekillermb,fiberfrax™,bactekillerbm101a,bactekillerbm102a,bactekillerbm501a,kaolinite, natural |
| IUPAC Name | dioxosilane;oxo(oxoalumanyloxy)alumane |
| InChI Key | HNPSIPDUKPIQMN-UHFFFAOYSA-N |
| Molecular Formula | Al2O5Si |
Sodium Peroxidisulfate, For Analysis, EMSURE™, MilliporeSigma™
CAS: 7775-27-1 Molecular Formula: Na2O8S2 Molecular Weight (g/mol): 238.092 InChI Key: CHQMHPLRPQMAMX-UHFFFAOYSA-L Synonym: sodium persulfate,sodium peroxydisulfate,sodium peroxodisulfate,peroxydisulfuric acid, disodium salt,disodium peroxodisulphate,sodium persulphate,unii-j49fyf16je,persulfate de sodium french,sodium peroxydisulphate,disodium sulfonatooxy sulfate PubChem CID: 62655 IUPAC Name: disodium;sulfonatooxy sulfate SMILES: [O-]S(=O)(=O)OOS(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 62655 |
|---|---|
| CAS | 7775-27-1 |
| Molecular Weight (g/mol) | 238.092 |
| SMILES | [O-]S(=O)(=O)OOS(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | sodium persulfate,sodium peroxydisulfate,sodium peroxodisulfate,peroxydisulfuric acid, disodium salt,disodium peroxodisulphate,sodium persulphate,unii-j49fyf16je,persulfate de sodium french,sodium peroxydisulphate,disodium sulfonatooxy sulfate |
| IUPAC Name | disodium;sulfonatooxy sulfate |
| InChI Key | CHQMHPLRPQMAMX-UHFFFAOYSA-L |
| Molecular Formula | Na2O8S2 |
Silver nitrate, 99.85%, for analysis
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
| CAS | 10035-04-8 |
|---|---|
| Molecular Formula | CaCl2. 2H2O |
Calcium dihydrogen phosphate hydrate, 97%
CAS: 301524-28-7 Molecular Formula: CaH4O8P2 Molecular Weight (g/mol): 234.05 MDL Number: MFCD00010898 InChI Key: YYRMJZQKEFZXMX-UHFFFAOYSA-L Synonym: Calcium phosphate, monobasic; Calcium tetrahydrogen diphosphate IUPAC Name: calcium didihydrogen phosphate SMILES: [Ca++].OP(O)([O-])=O.OP(O)([O-])=O
| CAS | 301524-28-7 |
|---|---|
| Molecular Weight (g/mol) | 234.05 |
| MDL Number | MFCD00010898 |
| SMILES | [Ca++].OP(O)([O-])=O.OP(O)([O-])=O |
| Synonym | Calcium phosphate, monobasic; Calcium tetrahydrogen diphosphate |
| IUPAC Name | calcium didihydrogen phosphate |
| InChI Key | YYRMJZQKEFZXMX-UHFFFAOYSA-L |
| Molecular Formula | CaH4O8P2 |
Sodium thiosulfate pentahydrate, ACS, 99.5-101.0%
CAS: 10102-17-7 Molecular Formula: H10Na2O8S2 Molecular Weight (g/mol): 248.172 MDL Number: MFCD00149186 InChI Key: PODWXQQNRWNDGD-UHFFFAOYSA-L Synonym: sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate PubChem CID: 61475 ChEBI: CHEBI:32150 IUPAC Name: disodium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;pentahydrate SMILES: O.O.O.O.O.[O-]S(=O)(=S)[O-].[Na+].[Na+]
| PubChem CID | 61475 |
|---|---|
| CAS | 10102-17-7 |
| Molecular Weight (g/mol) | 248.172 |
| ChEBI | CHEBI:32150 |
| MDL Number | MFCD00149186 |
| SMILES | O.O.O.O.O.[O-]S(=O)(=S)[O-].[Na+].[Na+] |
| Synonym | sodium thiosulfate pentahydrate,ametox,sodium thiosulfate, pentahydrate,antichlor,tinver,disodium thiosulfate pentahydrate,unii-hx1032v43m,ccris 3952,thiosulfuric acid, disodium salt, pentahydrate,sodium hyposulfite pentahydrate |
| IUPAC Name | disodium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane;pentahydrate |
| InChI Key | PODWXQQNRWNDGD-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O8S2 |